C19H28N4OS2 — CID 16564903
2-[[5-(butylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[(4-methylphenyl)methyl]-N-propylacetamide (PubChem CID 16564903) has the molecular formula C19H28N4OS2 and a molecular weight of 392.59 g/mol. Its IUPAC name is 2-[[5-(butylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[(4-methylphenyl)methyl]-N-propylacetamide.
| Compound Name | 2-[[5-(butylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[(4-methylphenyl)methyl]-N-propylacetamide |
|---|---|
| PubChem CID | 16564903 |
| Molecular Formula | C19H28N4OS2 |
| Molecular Weight | 392.59 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 2-[[5-(butylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[(4-methylphenyl)methyl]-N-propylacetamide |
| SMILES | CCCCNc1nnc(SCC(=O)N(CCC)Cc2ccc(C)cc2)s1 |
| InChI | InChI=1S/C19H28N4OS2/c1-4-6-11-20-18-21-22-19(26-18)25-14-17(24)23(12-5-2)13-16-9-7-15(3)8-10-16/h7-10H,4-6,11-14H2,1-3H3,(H,20,21) |
| InChIKey | XAXUCVIMKPEWOE-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.59 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|