C15H20N4OS2 — CID 2589017
N-butyl-2-[[5-(4-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide (PubChem CID 2589017) has the molecular formula C15H20N4OS2 and a molecular weight of 336.49 g/mol. Its IUPAC name is N-butyl-2-[[5-(4-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-butyl-2-[[5-(4-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 2589017 |
| Molecular Formula | C15H20N4OS2 |
| Molecular Weight | 336.49 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | N-butyl-2-[[5-(4-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
| SMILES | CCCCNC(=O)CSc1nnc(Nc2ccc(C)cc2)s1 |
| InChI | InChI=1S/C15H20N4OS2/c1-3-4-9-16-13(20)10-21-15-19-18-14(22-15)17-12-7-5-11(2)6-8-12/h5-8H,3-4,9-10H2,1-2H3,(H,16,20)(H,17,18) |
| InChIKey | BFPBXDVUDJMMCK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.49 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|