C17H24N4OS2 — CID 9483825
2-[[5-(2,3-dimethylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-pentylacetamide (PubChem CID 9483825) has the molecular formula C17H24N4OS2 and a molecular weight of 364.54 g/mol. Its IUPAC name is 2-[[5-(2,3-dimethylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-pentylacetamide.
| Compound Name | 2-[[5-(2,3-dimethylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-pentylacetamide |
|---|---|
| PubChem CID | 9483825 |
| Molecular Formula | C17H24N4OS2 |
| Molecular Weight | 364.54 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 2-[[5-(2,3-dimethylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-pentylacetamide |
| SMILES | CCCCCNC(=O)CSc1nnc(Nc2cccc(C)c2C)s1 |
| InChI | InChI=1S/C17H24N4OS2/c1-4-5-6-10-18-15(22)11-23-17-21-20-16(24-17)19-14-9-7-8-12(2)13(14)3/h7-9H,4-6,10-11H2,1-3H3,(H,18,22)(H,19,20) |
| InChIKey | JAMLNKITLGWBFU-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.54 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|