C16H21BrN4OS2 — CID 16500163
N-[(4-bromophenyl)methyl]-2-[[5-(butylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-methylacetamide (PubChem CID 16500163) has the molecular formula C16H21BrN4OS2 and a molecular weight of 429.41 g/mol. Its IUPAC name is N-[(4-bromophenyl)methyl]-2-[[5-(butylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-methylacetamide.
| Compound Name | N-[(4-bromophenyl)methyl]-2-[[5-(butylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-methylacetamide |
|---|---|
| PubChem CID | 16500163 |
| Molecular Formula | C16H21BrN4OS2 |
| Molecular Weight | 429.41 g/mol |
| Exact Mass | 428.03 |
| IUPAC Name | N-[(4-bromophenyl)methyl]-2-[[5-(butylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-methylacetamide |
| SMILES | CCCCNc1nnc(SCC(=O)N(C)Cc2ccc(Br)cc2)s1 |
| InChI | InChI=1S/C16H21BrN4OS2/c1-3-4-9-18-15-19-20-16(24-15)23-11-14(22)21(2)10-12-5-7-13(17)8-6-12/h5-8H,3-4,9-11H2,1-2H3,(H,18,19) |
| InChIKey | GEYDHQYXXAURGR-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.41 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|