C17H23N5O2S2 — CID 9105285
4-[[2-[[5-(butylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]-N,N-dimethylbenzamide (PubChem CID 9105285) has the molecular formula C17H23N5O2S2 and a molecular weight of 393.54 g/mol. Its IUPAC name is 4-[[2-[[5-(butylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]-N,N-dimethylbenzamide.
| Compound Name | 4-[[2-[[5-(butylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 9105285 |
| Molecular Formula | C17H23N5O2S2 |
| Molecular Weight | 393.54 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 4-[[2-[[5-(butylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]-N,N-dimethylbenzamide |
| SMILES | CCCCNc1nnc(SCC(=O)Nc2ccc(C(=O)N(C)C)cc2)s1 |
| InChI | InChI=1S/C17H23N5O2S2/c1-4-5-10-18-16-20-21-17(26-16)25-11-14(23)19-13-8-6-12(7-9-13)15(24)22(2)3/h6-9H,4-5,10-11H2,1-3H3,(H,18,20)(H,19,23) |
| InChIKey | WRKRDOBAHQYZIR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.54 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|