C13H24N4OS2 — CID 16500089
2-[[5-(butylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(3-methylbutyl)acetamide (PubChem CID 16500089) has the molecular formula C13H24N4OS2 and a molecular weight of 316.50 g/mol. Its IUPAC name is 2-[[5-(butylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(3-methylbutyl)acetamide.
| Compound Name | 2-[[5-(butylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(3-methylbutyl)acetamide |
|---|---|
| PubChem CID | 16500089 |
| Molecular Formula | C13H24N4OS2 |
| Molecular Weight | 316.50 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 2-[[5-(butylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(3-methylbutyl)acetamide |
| SMILES | CCCCNc1nnc(SCC(=O)NCCC(C)C)s1 |
| InChI | InChI=1S/C13H24N4OS2/c1-4-5-7-15-12-16-17-13(20-12)19-9-11(18)14-8-6-10(2)3/h10H,4-9H2,1-3H3,(H,14,18)(H,15,16) |
| InChIKey | OIVXIPTUFVYPCA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.50 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|