C8H14N4OS2 — CID 4805002
2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-butylacetamide (PubChem CID 4805002) has the molecular formula C8H14N4OS2 and a molecular weight of 246.36 g/mol. Its IUPAC name is 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-butylacetamide.
| Compound Name | 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-butylacetamide |
|---|---|
| PubChem CID | 4805002 |
| Molecular Formula | C8H14N4OS2 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-butylacetamide |
| SMILES | CCCCNC(=O)CSc1nnc(N)s1 |
| InChI | InChI=1S/C8H14N4OS2/c1-2-3-4-10-6(13)5-14-8-12-11-7(9)15-8/h2-5H2,1H3,(H2,9,11)(H,10,13) |
| InChIKey | TUVASLVQRNXGMX-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|