C13H17N5OS2 — CID 46986866
2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(4-pyridin-2-ylbutyl)acetamide (PubChem CID 46986866) has the molecular formula C13H17N5OS2 and a molecular weight of 323.45 g/mol. Its IUPAC name is 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(4-pyridin-2-ylbutyl)acetamide.
| Compound Name | 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(4-pyridin-2-ylbutyl)acetamide |
|---|---|
| PubChem CID | 46986866 |
| Molecular Formula | C13H17N5OS2 |
| Molecular Weight | 323.45 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(4-pyridin-2-ylbutyl)acetamide |
| SMILES | Nc1nnc(SCC(=O)NCCCCc2ccccn2)s1 |
| InChI | InChI=1S/C13H17N5OS2/c14-12-17-18-13(21-12)20-9-11(19)16-8-4-2-6-10-5-1-3-7-15-10/h1,3,5,7H,2,4,6,8-9H2,(H2,14,17)(H,16,19) |
| InChIKey | JRTCCAZAXLUEQP-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.45 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|