C11H18N4OS2 — CID 18777830
2-[[5-(butylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-cyclopropylacetamide (PubChem CID 18777830) has the molecular formula C11H18N4OS2 and a molecular weight of 286.43 g/mol. Its IUPAC name is 2-[[5-(butylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-cyclopropylacetamide.
| Compound Name | 2-[[5-(butylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-cyclopropylacetamide |
|---|---|
| PubChem CID | 18777830 |
| Molecular Formula | C11H18N4OS2 |
| Molecular Weight | 286.43 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 2-[[5-(butylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-cyclopropylacetamide |
| SMILES | CCCCNc1nnc(SCC(=O)NC2CC2)s1 |
| InChI | InChI=1S/C11H18N4OS2/c1-2-3-6-12-10-14-15-11(18-10)17-7-9(16)13-8-4-5-8/h8H,2-7H2,1H3,(H,12,14)(H,13,16) |
| InChIKey | INBCRPHVULMWRP-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.43 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|