C15H23N5OS2 — CID 18080509
2-[[5-(butylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(1-cyanocyclohexyl)acetamide (PubChem CID 18080509) has the molecular formula C15H23N5OS2 and a molecular weight of 353.52 g/mol. Its IUPAC name is 2-[[5-(butylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(1-cyanocyclohexyl)acetamide.
| Compound Name | 2-[[5-(butylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(1-cyanocyclohexyl)acetamide |
|---|---|
| PubChem CID | 18080509 |
| Molecular Formula | C15H23N5OS2 |
| Molecular Weight | 353.52 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 2-[[5-(butylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(1-cyanocyclohexyl)acetamide |
| SMILES | CCCCNc1nnc(SCC(=O)NC2(C#N)CCCCC2)s1 |
| InChI | InChI=1S/C15H23N5OS2/c1-2-3-9-17-13-19-20-14(23-13)22-10-12(21)18-15(11-16)7-5-4-6-8-15/h2-10H2,1H3,(H,17,19)(H,18,21) |
| InChIKey | AAXBBILDNRPWNF-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.52 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|