C14H15N5O2S2 — CID 7798307
4-[[2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]benzamide (PubChem CID 7798307) has the molecular formula C14H15N5O2S2 and a molecular weight of 349.44 g/mol. Its IUPAC name is 4-[[2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]benzamide.
| Compound Name | 4-[[2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 7798307 |
| Molecular Formula | C14H15N5O2S2 |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 4-[[2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]benzamide |
| SMILES | C=CCNc1nnc(SCC(=O)Nc2ccc(C(N)=O)cc2)s1 |
| InChI | InChI=1S/C14H15N5O2S2/c1-2-7-16-13-18-19-14(23-13)22-8-11(20)17-10-5-3-9(4-6-10)12(15)21/h2-6H,1,7-8H2,(H2,15,21)(H,16,18)(H,17,20) |
| InChIKey | WNLRPRZBROYRHQ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|