C21H24FN5OS2 — CID 24519679
N-[[4-(dimethylamino)phenyl]methyl]-2-[[5-[(4-fluorophenyl)methylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-methylacetamide (PubChem CID 24519679) has the molecular formula C21H24FN5OS2 and a molecular weight of 445.59 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-2-[[5-[(4-fluorophenyl)methylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-methylacetamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-2-[[5-[(4-fluorophenyl)methylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-methylacetamide |
|---|---|
| PubChem CID | 24519679 |
| Molecular Formula | C21H24FN5OS2 |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-2-[[5-[(4-fluorophenyl)methylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-methylacetamide |
| SMILES | CN(Cc1ccc(N(C)C)cc1)C(=O)CSc1nnc(NCc2ccc(F)cc2)s1 |
| InChI | InChI=1S/C21H24FN5OS2/c1-26(2)18-10-6-16(7-11-18)13-27(3)19(28)14-29-21-25-24-20(30-21)23-12-15-4-8-17(22)9-5-15/h4-11H,12-14H2,1-3H3,(H,23,24) |
| InChIKey | DTUYGLWDAQMTCE-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|