C22H26N6O2S2 — CID 55570873
2-[[5-(3-acetamidoanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[[4-(dimethylamino)phenyl]methyl]-N-methylacetamide (PubChem CID 55570873) has the molecular formula C22H26N6O2S2 and a molecular weight of 470.62 g/mol. Its IUPAC name is 2-[[5-(3-acetamidoanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[[4-(dimethylamino)phenyl]methyl]-N-methylacetamide.
| Compound Name | 2-[[5-(3-acetamidoanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[[4-(dimethylamino)phenyl]methyl]-N-methylacetamide |
|---|---|
| PubChem CID | 55570873 |
| Molecular Formula | C22H26N6O2S2 |
| Molecular Weight | 470.62 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | 2-[[5-(3-acetamidoanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[[4-(dimethylamino)phenyl]methyl]-N-methylacetamide |
| SMILES | CC(=O)Nc1cccc(Nc2nnc(SCC(=O)N(C)Cc3ccc(N(C)C)cc3)s2)c1 |
| InChI | InChI=1S/C22H26N6O2S2/c1-15(29)23-17-6-5-7-18(12-17)24-21-25-26-22(32-21)31-14-20(30)28(4)13-16-8-10-19(11-9-16)27(2)3/h5-12H,13-14H2,1-4H3,(H,23,29)(H,24,25) |
| InChIKey | VXIPMMHHYPJMGX-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.62 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|