C16H21N3OS2 — CID 40749930
N-[[4-(dimethylamino)phenyl]methyl]-N-methyl-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]acetamide (PubChem CID 40749930) has the molecular formula C16H21N3OS2 and a molecular weight of 335.50 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-N-methyl-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-N-methyl-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 40749930 |
| Molecular Formula | C16H21N3OS2 |
| Molecular Weight | 335.50 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-N-methyl-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]acetamide |
| SMILES | Cc1csc(SCC(=O)N(C)Cc2ccc(N(C)C)cc2)n1 |
| InChI | InChI=1S/C16H21N3OS2/c1-12-10-21-16(17-12)22-11-15(20)19(4)9-13-5-7-14(8-6-13)18(2)3/h5-8,10H,9,11H2,1-4H3 |
| InChIKey | UOXMOVPCICOYHU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.50 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|