C20H30N4O2S — CID 55640165
N-[[4-(dimethylamino)phenyl]methyl]-2-[1-(2-methoxyethyl)-4,5-dimethylimidazol-2-yl]sulfanyl-N-methylacetamide (PubChem CID 55640165) has the molecular formula C20H30N4O2S and a molecular weight of 390.55 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-2-[1-(2-methoxyethyl)-4,5-dimethylimidazol-2-yl]sulfanyl-N-methylacetamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-2-[1-(2-methoxyethyl)-4,5-dimethylimidazol-2-yl]sulfanyl-N-methylacetamide |
|---|---|
| PubChem CID | 55640165 |
| Molecular Formula | C20H30N4O2S |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-2-[1-(2-methoxyethyl)-4,5-dimethylimidazol-2-yl]sulfanyl-N-methylacetamide |
| SMILES | COCCn1c(SCC(=O)N(C)Cc2ccc(N(C)C)cc2)nc(C)c1C |
| InChI | InChI=1S/C20H30N4O2S/c1-15-16(2)24(11-12-26-6)20(21-15)27-14-19(25)23(5)13-17-7-9-18(10-8-17)22(3)4/h7-10H,11-14H2,1-6H3 |
| InChIKey | OMDWLXOTPOBZTM-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|