C23H27N5O4S3 — CID 44956938
N-[5-[2-(4-butylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-4-(dimethylsulfamoyl)benzamide (PubChem CID 44956938) has the molecular formula C23H27N5O4S3 and a molecular weight of 533.70 g/mol. Its IUPAC name is N-[5-[2-(4-butylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-4-(dimethylsulfamoyl)benzamide.
| Compound Name | N-[5-[2-(4-butylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-4-(dimethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 44956938 |
| Molecular Formula | C23H27N5O4S3 |
| Molecular Weight | 533.70 g/mol |
| Exact Mass | 533.12 |
| IUPAC Name | N-[5-[2-(4-butylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-4-(dimethylsulfamoyl)benzamide |
| SMILES | CCCCc1ccc(NC(=O)CSc2nnc(NC(=O)c3ccc(S(=O)(=O)N(C)C)cc3)s2)cc1 |
| InChI | InChI=1S/C23H27N5O4S3/c1-4-5-6-16-7-11-18(12-8-16)24-20(29)15-33-23-27-26-22(34-23)25-21(30)17-9-13-19(14-10-17)35(31,32)28(2)3/h7-14H,4-6,15H2,1-3H3,(H,24,29)(H,25,26,30) |
| InChIKey | FJKFUZLCIQCSBH-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 121.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.70 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|