C22H23N3O3S2 — CID 42805453
4-butyl-N-[5-[2-(4-methoxyphenyl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 42805453) has the molecular formula C22H23N3O3S2 and a molecular weight of 441.58 g/mol. Its IUPAC name is 4-butyl-N-[5-[2-(4-methoxyphenyl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 4-butyl-N-[5-[2-(4-methoxyphenyl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 42805453 |
| Molecular Formula | C22H23N3O3S2 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | 4-butyl-N-[5-[2-(4-methoxyphenyl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | CCCCc1ccc(C(=O)Nc2nnc(SCC(=O)c3ccc(OC)cc3)s2)cc1 |
| InChI | InChI=1S/C22H23N3O3S2/c1-3-4-5-15-6-8-17(9-7-15)20(27)23-21-24-25-22(30-21)29-14-19(26)16-10-12-18(28-2)13-11-16/h6-13H,3-5,14H2,1-2H3,(H,23,24,27) |
| InChIKey | GRFLCUNYOILXJU-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|