C24H27N3O4S2 — CID 42667058
3,5-dimethoxy-N-[5-[2-oxo-2-(4-pentylphenyl)ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 42667058) has the molecular formula C24H27N3O4S2 and a molecular weight of 485.63 g/mol. Its IUPAC name is 3,5-dimethoxy-N-[5-[2-oxo-2-(4-pentylphenyl)ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 3,5-dimethoxy-N-[5-[2-oxo-2-(4-pentylphenyl)ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 42667058 |
| Molecular Formula | C24H27N3O4S2 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | 3,5-dimethoxy-N-[5-[2-oxo-2-(4-pentylphenyl)ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | CCCCCc1ccc(C(=O)CSc2nnc(NC(=O)c3cc(OC)cc(OC)c3)s2)cc1 |
| InChI | InChI=1S/C24H27N3O4S2/c1-4-5-6-7-16-8-10-17(11-9-16)21(28)15-32-24-27-26-23(33-24)25-22(29)18-12-19(30-2)14-20(13-18)31-3/h8-14H,4-7,15H2,1-3H3,(H,25,26,29) |
| InChIKey | YROFFPHXULIPRQ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|