C17H20ClF3N4O2S2 — CID 26207283
(2R)-N-[4-chloro-3-(trifluoromethyl)phenyl]-2-[[5-(3-ethoxypropylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide (PubChem CID 26207283) has the molecular formula C17H20ClF3N4O2S2 and a molecular weight of 468.95 g/mol. Its IUPAC name is (2R)-N-[4-chloro-3-(trifluoromethyl)phenyl]-2-[[5-(3-ethoxypropylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide.
| Compound Name | (2R)-N-[4-chloro-3-(trifluoromethyl)phenyl]-2-[[5-(3-ethoxypropylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 26207283 |
| Molecular Formula | C17H20ClF3N4O2S2 |
| Molecular Weight | 468.95 g/mol |
| Exact Mass | 468.07 |
| IUPAC Name | (2R)-N-[4-chloro-3-(trifluoromethyl)phenyl]-2-[[5-(3-ethoxypropylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide |
| SMILES | CCOCCCNc1nnc(S[C@H](C)C(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C17H20ClF3N4O2S2/c1-3-27-8-4-7-22-15-24-25-16(29-15)28-10(2)14(26)23-11-5-6-13(18)12(9-11)17(19,20)21/h5-6,9-10H,3-4,7-8H2,1-2H3,(H,22,24)(H,23,26)/t10-/m1/s1 |
| InChIKey | PERNYVRGJTYDKA-SNVBAGLBSA-N |
| XLogP | 5.17 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.95 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|