C12H22N4O2S2 — CID 47145637
N-(3-ethoxypropyl)-2-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide (PubChem CID 47145637) has the molecular formula C12H22N4O2S2 and a molecular weight of 318.47 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-2-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide.
| Compound Name | N-(3-ethoxypropyl)-2-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 47145637 |
| Molecular Formula | C12H22N4O2S2 |
| Molecular Weight | 318.47 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | N-(3-ethoxypropyl)-2-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide |
| SMILES | CCNc1nnc(SC(C)C(=O)NCCCOCC)s1 |
| InChI | InChI=1S/C12H22N4O2S2/c1-4-13-11-15-16-12(20-11)19-9(3)10(17)14-7-6-8-18-5-2/h9H,4-8H2,1-3H3,(H,13,15)(H,14,17) |
| InChIKey | GEWDHSIBMVVKTM-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.47 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|