C11H19N5O2S2 — CID 9101909
(2S)-2-[[5-(butylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(methylcarbamoyl)propanamide (PubChem CID 9101909) has the molecular formula C11H19N5O2S2 and a molecular weight of 317.44 g/mol. Its IUPAC name is (2S)-2-[[5-(butylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(methylcarbamoyl)propanamide.
| Compound Name | (2S)-2-[[5-(butylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(methylcarbamoyl)propanamide |
|---|---|
| PubChem CID | 9101909 |
| Molecular Formula | C11H19N5O2S2 |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | (2S)-2-[[5-(butylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(methylcarbamoyl)propanamide |
| SMILES | CCCCNc1nnc(S[C@@H](C)C(=O)NC(=O)NC)s1 |
| InChI | InChI=1S/C11H19N5O2S2/c1-4-5-6-13-10-15-16-11(20-10)19-7(2)8(17)14-9(18)12-3/h7H,4-6H2,1-3H3,(H,13,15)(H2,12,14,17,18)/t7-/m0/s1 |
| InChIKey | HKMZKGQELZHAGX-ZETCQYMHSA-N |
| XLogP | 1.69 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|