C12H20N4OS2 — CID 18091281
2-[[5-(butylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-prop-2-enylpropanamide (PubChem CID 18091281) has the molecular formula C12H20N4OS2 and a molecular weight of 300.45 g/mol. Its IUPAC name is 2-[[5-(butylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-prop-2-enylpropanamide.
| Compound Name | 2-[[5-(butylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 18091281 |
| Molecular Formula | C12H20N4OS2 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 2-[[5-(butylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-prop-2-enylpropanamide |
| SMILES | C=CCNC(=O)C(C)Sc1nnc(NCCCC)s1 |
| InChI | InChI=1S/C12H20N4OS2/c1-4-6-8-14-11-15-16-12(19-11)18-9(3)10(17)13-7-5-2/h5,9H,2,4,6-8H2,1,3H3,(H,13,17)(H,14,15) |
| InChIKey | XRGXUZMFOVBGAA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|