C16H21ClN4OS2 — CID 18091282
2-[[5-(butylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[(2-chlorophenyl)methyl]propanamide (PubChem CID 18091282) has the molecular formula C16H21ClN4OS2 and a molecular weight of 384.96 g/mol. Its IUPAC name is 2-[[5-(butylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[(2-chlorophenyl)methyl]propanamide.
| Compound Name | 2-[[5-(butylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[(2-chlorophenyl)methyl]propanamide |
|---|---|
| PubChem CID | 18091282 |
| Molecular Formula | C16H21ClN4OS2 |
| Molecular Weight | 384.96 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | 2-[[5-(butylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[(2-chlorophenyl)methyl]propanamide |
| SMILES | CCCCNc1nnc(SC(C)C(=O)NCc2ccccc2Cl)s1 |
| InChI | InChI=1S/C16H21ClN4OS2/c1-3-4-9-18-15-20-21-16(24-15)23-11(2)14(22)19-10-12-7-5-6-8-13(12)17/h5-8,11H,3-4,9-10H2,1-2H3,(H,18,20)(H,19,22) |
| InChIKey | BPEAAAGHWSUPCI-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.96 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|