C11H18N4O2S2 — CID 9378448
(2S)-2-[[5-(cyclopropylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-methoxyethyl)propanamide (PubChem CID 9378448) has the molecular formula C11H18N4O2S2 and a molecular weight of 302.43 g/mol. Its IUPAC name is (2S)-2-[[5-(cyclopropylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-methoxyethyl)propanamide.
| Compound Name | (2S)-2-[[5-(cyclopropylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 9378448 |
| Molecular Formula | C11H18N4O2S2 |
| Molecular Weight | 302.43 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | (2S)-2-[[5-(cyclopropylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)[C@H](C)Sc1nnc(NC2CC2)s1 |
| InChI | InChI=1S/C11H18N4O2S2/c1-7(9(16)12-5-6-17-2)18-11-15-14-10(19-11)13-8-3-4-8/h7-8H,3-6H2,1-2H3,(H,12,16)(H,13,14)/t7-/m0/s1 |
| InChIKey | HBPRGAXMOAAGGQ-ZETCQYMHSA-N |
| XLogP | 1.36 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.43 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|