C18H23FN4O2S2 — CID 16589423
N-cyclopropyl-2-[[5-(3-ethoxypropylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-(4-fluorophenyl)acetamide (PubChem CID 16589423) has the molecular formula C18H23FN4O2S2 and a molecular weight of 410.54 g/mol. Its IUPAC name is N-cyclopropyl-2-[[5-(3-ethoxypropylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-(4-fluorophenyl)acetamide.
| Compound Name | N-cyclopropyl-2-[[5-(3-ethoxypropylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 16589423 |
| Molecular Formula | C18H23FN4O2S2 |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | N-cyclopropyl-2-[[5-(3-ethoxypropylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-(4-fluorophenyl)acetamide |
| SMILES | CCOCCCNc1nnc(SC(C(=O)NC2CC2)c2ccc(F)cc2)s1 |
| InChI | InChI=1S/C18H23FN4O2S2/c1-2-25-11-3-10-20-17-22-23-18(27-17)26-15(16(24)21-14-8-9-14)12-4-6-13(19)7-5-12/h4-7,14-15H,2-3,8-11H2,1H3,(H,20,22)(H,21,24) |
| InChIKey | UUVQWIBPCHCZNF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|