C23H31N5O3S2 — CID 40833321
N-[5-[2-(3-acetamidoanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-4-butylcyclohexane-1-carboxamide (PubChem CID 40833321) has the molecular formula C23H31N5O3S2 and a molecular weight of 489.67 g/mol. Its IUPAC name is N-[5-[2-(3-acetamidoanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-4-butylcyclohexane-1-carboxamide.
| Compound Name | N-[5-[2-(3-acetamidoanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-4-butylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 40833321 |
| Molecular Formula | C23H31N5O3S2 |
| Molecular Weight | 489.67 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | N-[5-[2-(3-acetamidoanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-4-butylcyclohexane-1-carboxamide |
| SMILES | CCCCC1CCC(C(=O)Nc2nnc(SCC(=O)Nc3cccc(NC(C)=O)c3)s2)CC1 |
| InChI | InChI=1S/C23H31N5O3S2/c1-3-4-6-16-9-11-17(12-10-16)21(31)26-22-27-28-23(33-22)32-14-20(30)25-19-8-5-7-18(13-19)24-15(2)29/h5,7-8,13,16-17H,3-4,6,9-12,14H2,1-2H3,(H,24,29)(H,25,30)(H,26,27,31) |
| InChIKey | JDGUKTBGIKOTAJ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 113.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.67 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|