C18H14F2N4O3S2 — CID 40833037
2,6-difluoro-N-[5-[2-(3-methoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 40833037) has the molecular formula C18H14F2N4O3S2 and a molecular weight of 436.47 g/mol. Its IUPAC name is 2,6-difluoro-N-[5-[2-(3-methoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 2,6-difluoro-N-[5-[2-(3-methoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 40833037 |
| Molecular Formula | C18H14F2N4O3S2 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | 2,6-difluoro-N-[5-[2-(3-methoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | COc1cccc(NC(=O)CSc2nnc(NC(=O)c3c(F)cccc3F)s2)c1 |
| InChI | InChI=1S/C18H14F2N4O3S2/c1-27-11-5-2-4-10(8-11)21-14(25)9-28-18-24-23-17(29-18)22-16(26)15-12(19)6-3-7-13(15)20/h2-8H,9H2,1H3,(H,21,25)(H,22,23,26) |
| InChIKey | QZLQGOIUKKLDMA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|