C19H16F2N4O4S2 — CID 40833039
N-[5-[2-(2,5-dimethoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2,6-difluorobenzamide (PubChem CID 40833039) has the molecular formula C19H16F2N4O4S2 and a molecular weight of 466.49 g/mol. Its IUPAC name is N-[5-[2-(2,5-dimethoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2,6-difluorobenzamide.
| Compound Name | N-[5-[2-(2,5-dimethoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 40833039 |
| Molecular Formula | C19H16F2N4O4S2 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.06 |
| IUPAC Name | N-[5-[2-(2,5-dimethoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2,6-difluorobenzamide |
| SMILES | COc1ccc(OC)c(NC(=O)CSc2nnc(NC(=O)c3c(F)cccc3F)s2)c1 |
| InChI | InChI=1S/C19H16F2N4O4S2/c1-28-10-6-7-14(29-2)13(8-10)22-15(26)9-30-19-25-24-18(31-19)23-17(27)16-11(20)4-3-5-12(16)21/h3-8H,9H2,1-2H3,(H,22,26)(H,23,24,27) |
| InChIKey | QGXXGRDRMDGDJP-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|