C20H17N5O6S2 — CID 121030159
N-[5-[2-(2,5-dimethoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-5-(furan-2-yl)-1,2-oxazole-3-carboxamide (PubChem CID 121030159) has the molecular formula C20H17N5O6S2 and a molecular weight of 487.52 g/mol. Its IUPAC name is N-[5-[2-(2,5-dimethoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-5-(furan-2-yl)-1,2-oxazole-3-carboxamide.
| Compound Name | N-[5-[2-(2,5-dimethoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-5-(furan-2-yl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 121030159 |
| Molecular Formula | C20H17N5O6S2 |
| Molecular Weight | 487.52 g/mol |
| Exact Mass | 487.06 |
| IUPAC Name | N-[5-[2-(2,5-dimethoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-5-(furan-2-yl)-1,2-oxazole-3-carboxamide |
| SMILES | COc1ccc(OC)c(NC(=O)CSc2nnc(NC(=O)c3cc(-c4ccco4)on3)s2)c1 |
| InChI | InChI=1S/C20H17N5O6S2/c1-28-11-5-6-14(29-2)12(8-11)21-17(26)10-32-20-24-23-19(33-20)22-18(27)13-9-16(31-25-13)15-4-3-7-30-15/h3-9H,10H2,1-2H3,(H,21,26)(H,22,23,27) |
| InChIKey | GDEJMRNZPUGECT-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 141.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.52 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|