C21H17N5O6S2 — CID 121030171
ethyl 4-[[2-[[5-[[5-(furan-2-yl)-1,2-oxazole-3-carbonyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]benzoate (PubChem CID 121030171) has the molecular formula C21H17N5O6S2 and a molecular weight of 499.53 g/mol. Its IUPAC name is ethyl 4-[[2-[[5-[[5-(furan-2-yl)-1,2-oxazole-3-carbonyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[[5-[[5-(furan-2-yl)-1,2-oxazole-3-carbonyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 121030171 |
| Molecular Formula | C21H17N5O6S2 |
| Molecular Weight | 499.53 g/mol |
| Exact Mass | 499.06 |
| IUPAC Name | ethyl 4-[[2-[[5-[[5-(furan-2-yl)-1,2-oxazole-3-carbonyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CSc2nnc(NC(=O)c3cc(-c4ccco4)on3)s2)cc1 |
| InChI | InChI=1S/C21H17N5O6S2/c1-2-30-19(29)12-5-7-13(8-6-12)22-17(27)11-33-21-25-24-20(34-21)23-18(28)14-10-16(32-26-14)15-4-3-9-31-15/h3-10H,2,11H2,1H3,(H,22,27)(H,23,24,28) |
| InChIKey | RQCUGIZBEIVHSN-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 149.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.53 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|