C13H10N4O3S2 — CID 121030121
5-(furan-2-yl)-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)-1,2-oxazole-3-carboxamide (PubChem CID 121030121) has the molecular formula C13H10N4O3S2 and a molecular weight of 334.38 g/mol. Its IUPAC name is 5-(furan-2-yl)-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)-1,2-oxazole-3-carboxamide.
| Compound Name | 5-(furan-2-yl)-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 121030121 |
| Molecular Formula | C13H10N4O3S2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | 5-(furan-2-yl)-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)-1,2-oxazole-3-carboxamide |
| SMILES | C=CCSc1nnc(NC(=O)c2cc(-c3ccco3)on2)s1 |
| InChI | InChI=1S/C13H10N4O3S2/c1-2-6-21-13-16-15-12(22-13)14-11(18)8-7-10(20-17-8)9-4-3-5-19-9/h2-5,7H,1,6H2,(H,14,15,18) |
| InChIKey | JKKLDKLBXZMDPC-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 94.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|