C13H10N4OS2 — CID 8697306
3-cyano-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 8697306) has the molecular formula C13H10N4OS2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 3-cyano-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide.
| Compound Name | 3-cyano-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 8697306 |
| Molecular Formula | C13H10N4OS2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | 3-cyano-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | C=CCSc1nnc(NC(=O)c2cccc(C#N)c2)s1 |
| InChI | InChI=1S/C13H10N4OS2/c1-2-6-19-13-17-16-12(20-13)15-11(18)10-5-3-4-9(7-10)8-14/h2-5,7H,1,6H2,(H,15,16,18) |
| InChIKey | ZXOZBSPZXJRUCE-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|