C11H9BrN4OS2 — CID 18075092
5-bromo-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)pyridine-3-carboxamide (PubChem CID 18075092) has the molecular formula C11H9BrN4OS2 and a molecular weight of 357.26 g/mol. Its IUPAC name is 5-bromo-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)pyridine-3-carboxamide.
| Compound Name | 5-bromo-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 18075092 |
| Molecular Formula | C11H9BrN4OS2 |
| Molecular Weight | 357.26 g/mol |
| Exact Mass | 355.94 |
| IUPAC Name | 5-bromo-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)pyridine-3-carboxamide |
| SMILES | C=CCSc1nnc(NC(=O)c2cncc(Br)c2)s1 |
| InChI | InChI=1S/C11H9BrN4OS2/c1-2-3-18-11-16-15-10(19-11)14-9(17)7-4-8(12)6-13-5-7/h2,4-6H,1,3H2,(H,14,15,17) |
| InChIKey | QRGKIEQMEOXDPZ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.26 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|