C12H11BrN4O3S2 — CID 42993207
ethyl 2-[[5-[(5-bromopyridine-3-carbonyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate (PubChem CID 42993207) has the molecular formula C12H11BrN4O3S2 and a molecular weight of 403.28 g/mol. Its IUPAC name is ethyl 2-[[5-[(5-bromopyridine-3-carbonyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate.
| Compound Name | ethyl 2-[[5-[(5-bromopyridine-3-carbonyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 42993207 |
| Molecular Formula | C12H11BrN4O3S2 |
| Molecular Weight | 403.28 g/mol |
| Exact Mass | 401.95 |
| IUPAC Name | ethyl 2-[[5-[(5-bromopyridine-3-carbonyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
| SMILES | CCOC(=O)CSc1nnc(NC(=O)c2cncc(Br)c2)s1 |
| InChI | InChI=1S/C12H11BrN4O3S2/c1-2-20-9(18)6-21-12-17-16-11(22-12)15-10(19)7-3-8(13)5-14-4-7/h3-5H,2,6H2,1H3,(H,15,16,19) |
| InChIKey | QQILNLXSCDDVKV-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.28 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|