C15H15N3O4S2 — CID 39119724
ethyl 2-[[5-(2,3-dihydro-1-benzofuran-5-carbonylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetate (PubChem CID 39119724) has the molecular formula C15H15N3O4S2 and a molecular weight of 365.44 g/mol. Its IUPAC name is ethyl 2-[[5-(2,3-dihydro-1-benzofuran-5-carbonylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetate.
| Compound Name | ethyl 2-[[5-(2,3-dihydro-1-benzofuran-5-carbonylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 39119724 |
| Molecular Formula | C15H15N3O4S2 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | ethyl 2-[[5-(2,3-dihydro-1-benzofuran-5-carbonylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
| SMILES | CCOC(=O)CSc1nnc(NC(=O)c2ccc3c(c2)CCO3)s1 |
| InChI | InChI=1S/C15H15N3O4S2/c1-2-21-12(19)8-23-15-18-17-14(24-15)16-13(20)10-3-4-11-9(7-10)5-6-22-11/h3-4,7H,2,5-6,8H2,1H3,(H,16,17,20) |
| InChIKey | OQIBOYRYUQCBBG-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|