C12H10N4OS2 — CID 2635787
3-cyano-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 2635787) has the molecular formula C12H10N4OS2 and a molecular weight of 290.37 g/mol. Its IUPAC name is 3-cyano-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide.
| Compound Name | 3-cyano-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 2635787 |
| Molecular Formula | C12H10N4OS2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | 3-cyano-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | CCSc1nnc(NC(=O)c2cccc(C#N)c2)s1 |
| InChI | InChI=1S/C12H10N4OS2/c1-2-18-12-16-15-11(19-12)14-10(17)9-5-3-4-8(6-9)7-13/h3-6H,2H2,1H3,(H,14,15,17) |
| InChIKey | HGNIXOYKSJGMQG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|