C12H8N4O3S2 — CID 61283574
2-[[5-[(3-cyanobenzoyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetic acid (PubChem CID 61283574) has the molecular formula C12H8N4O3S2 and a molecular weight of 320.36 g/mol. Its IUPAC name is 2-[[5-[(3-cyanobenzoyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetic acid.
| Compound Name | 2-[[5-[(3-cyanobenzoyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 61283574 |
| Molecular Formula | C12H8N4O3S2 |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.00 |
| IUPAC Name | 2-[[5-[(3-cyanobenzoyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetic acid |
| SMILES | N#Cc1cccc(C(=O)Nc2nnc(SCC(=O)O)s2)c1 |
| InChI | InChI=1S/C12H8N4O3S2/c13-5-7-2-1-3-8(4-7)10(19)14-11-15-16-12(21-11)20-6-9(17)18/h1-4H,6H2,(H,17,18)(H,14,15,19) |
| InChIKey | WQPKHRSYFZTTSC-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|