C18H15ClN4O3S3 — CID 100527080
4-chloro-3-(phenylsulfamoyl)-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 100527080) has the molecular formula C18H15ClN4O3S3 and a molecular weight of 467.00 g/mol. Its IUPAC name is 4-chloro-3-(phenylsulfamoyl)-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide.
| Compound Name | 4-chloro-3-(phenylsulfamoyl)-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 100527080 |
| Molecular Formula | C18H15ClN4O3S3 |
| Molecular Weight | 467.00 g/mol |
| Exact Mass | 466.00 |
| IUPAC Name | 4-chloro-3-(phenylsulfamoyl)-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | C=CCSc1nnc(NC(=O)c2ccc(Cl)c(S(=O)(=O)Nc3ccccc3)c2)s1 |
| InChI | InChI=1S/C18H15ClN4O3S3/c1-2-10-27-18-22-21-17(28-18)20-16(24)12-8-9-14(19)15(11-12)29(25,26)23-13-6-4-3-5-7-13/h2-9,11,23H,1,10H2,(H,20,21,24) |
| InChIKey | WXPVXOKLROWKNQ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.00 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|