C21H23ClN4O3S3 — CID 100701826
4-chloro-3-[(2,4-dimethylphenyl)sulfamoyl]-N-[5-(2-methylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 100701826) has the molecular formula C21H23ClN4O3S3 and a molecular weight of 511.09 g/mol. Its IUPAC name is 4-chloro-3-[(2,4-dimethylphenyl)sulfamoyl]-N-[5-(2-methylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 4-chloro-3-[(2,4-dimethylphenyl)sulfamoyl]-N-[5-(2-methylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 100701826 |
| Molecular Formula | C21H23ClN4O3S3 |
| Molecular Weight | 511.09 g/mol |
| Exact Mass | 510.06 |
| IUPAC Name | 4-chloro-3-[(2,4-dimethylphenyl)sulfamoyl]-N-[5-(2-methylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2cc(C(=O)Nc3nnc(SCC(C)C)s3)ccc2Cl)c(C)c1 |
| InChI | InChI=1S/C21H23ClN4O3S3/c1-12(2)11-30-21-25-24-20(31-21)23-19(27)15-6-7-16(22)18(10-15)32(28,29)26-17-8-5-13(3)9-14(17)4/h5-10,12,26H,11H2,1-4H3,(H,23,24,27) |
| InChIKey | OLYVNQGJJBPMND-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.09 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|