C19H20N4O3S3 — CID 29407190
N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-4-methyl-3-[(4-methylphenyl)sulfamoyl]benzamide (PubChem CID 29407190) has the molecular formula C19H20N4O3S3 and a molecular weight of 448.60 g/mol. Its IUPAC name is N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-4-methyl-3-[(4-methylphenyl)sulfamoyl]benzamide.
| Compound Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-4-methyl-3-[(4-methylphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 29407190 |
| Molecular Formula | C19H20N4O3S3 |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-4-methyl-3-[(4-methylphenyl)sulfamoyl]benzamide |
| SMILES | CCSc1nnc(NC(=O)c2ccc(C)c(S(=O)(=O)Nc3ccc(C)cc3)c2)s1 |
| InChI | InChI=1S/C19H20N4O3S3/c1-4-27-19-22-21-18(28-19)20-17(24)14-8-7-13(3)16(11-14)29(25,26)23-15-9-5-12(2)6-10-15/h5-11,23H,4H2,1-3H3,(H,20,21,24) |
| InChIKey | UXPNGRYWCIWNAH-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|