C21H24N4O3S3 — CID 100533668
3-[(3,5-dimethylphenyl)sulfamoyl]-4-methyl-N-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 100533668) has the molecular formula C21H24N4O3S3 and a molecular weight of 476.65 g/mol. Its IUPAC name is 3-[(3,5-dimethylphenyl)sulfamoyl]-4-methyl-N-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide.
| Compound Name | 3-[(3,5-dimethylphenyl)sulfamoyl]-4-methyl-N-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 100533668 |
| Molecular Formula | C21H24N4O3S3 |
| Molecular Weight | 476.65 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | 3-[(3,5-dimethylphenyl)sulfamoyl]-4-methyl-N-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | CCCSc1nnc(NC(=O)c2ccc(C)c(S(=O)(=O)Nc3cc(C)cc(C)c3)c2)s1 |
| InChI | InChI=1S/C21H24N4O3S3/c1-5-8-29-21-24-23-20(30-21)22-19(26)16-7-6-15(4)18(12-16)31(27,28)25-17-10-13(2)9-14(3)11-17/h6-7,9-12,25H,5,8H2,1-4H3,(H,22,23,26) |
| InChIKey | XRHQMMQKWMXBBI-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.65 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|