C13H14FN3O2S2 — CID 100615854
3-fluoro-4-methoxy-N-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 100615854) has the molecular formula C13H14FN3O2S2 and a molecular weight of 327.41 g/mol. Its IUPAC name is 3-fluoro-4-methoxy-N-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide.
| Compound Name | 3-fluoro-4-methoxy-N-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 100615854 |
| Molecular Formula | C13H14FN3O2S2 |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | 3-fluoro-4-methoxy-N-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | CCCSc1nnc(NC(=O)c2ccc(OC)c(F)c2)s1 |
| InChI | InChI=1S/C13H14FN3O2S2/c1-3-6-20-13-17-16-12(21-13)15-11(18)8-4-5-10(19-2)9(14)7-8/h4-5,7H,3,6H2,1-2H3,(H,15,16,18) |
| InChIKey | XZBJAZYSMSOKGS-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|