C13H12ClN3O4S2 — CID 100572536
methyl 2-[[5-[(3-chloro-4-methoxybenzoyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate (PubChem CID 100572536) has the molecular formula C13H12ClN3O4S2 and a molecular weight of 373.84 g/mol. Its IUPAC name is methyl 2-[[5-[(3-chloro-4-methoxybenzoyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate.
| Compound Name | methyl 2-[[5-[(3-chloro-4-methoxybenzoyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 100572536 |
| Molecular Formula | C13H12ClN3O4S2 |
| Molecular Weight | 373.84 g/mol |
| Exact Mass | 373.00 |
| IUPAC Name | methyl 2-[[5-[(3-chloro-4-methoxybenzoyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
| SMILES | COC(=O)CSc1nnc(NC(=O)c2ccc(OC)c(Cl)c2)s1 |
| InChI | InChI=1S/C13H12ClN3O4S2/c1-20-9-4-3-7(5-8(9)14)11(19)15-12-16-17-13(23-12)22-6-10(18)21-2/h3-5H,6H2,1-2H3,(H,15,16,19) |
| InChIKey | CTNZZOGIDLPEKD-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.84 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|