C12H10IN3O3S2 — CID 100733928
methyl 2-[[5-[(4-iodobenzoyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate (PubChem CID 100733928) has the molecular formula C12H10IN3O3S2 and a molecular weight of 435.27 g/mol. Its IUPAC name is methyl 2-[[5-[(4-iodobenzoyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate.
| Compound Name | methyl 2-[[5-[(4-iodobenzoyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 100733928 |
| Molecular Formula | C12H10IN3O3S2 |
| Molecular Weight | 435.27 g/mol |
| Exact Mass | 434.92 |
| IUPAC Name | methyl 2-[[5-[(4-iodobenzoyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
| SMILES | COC(=O)CSc1nnc(NC(=O)c2ccc(I)cc2)s1 |
| InChI | InChI=1S/C12H10IN3O3S2/c1-19-9(17)6-20-12-16-15-11(21-12)14-10(18)7-2-4-8(13)5-3-7/h2-5H,6H2,1H3,(H,14,15,18) |
| InChIKey | HECBVQZALDMNFZ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.27 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|