C19H18N4O5S3 — CID 100531277
methyl 2-[[5-[[4-(benzenesulfonamido)-3-methylbenzoyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate (PubChem CID 100531277) has the molecular formula C19H18N4O5S3 and a molecular weight of 478.58 g/mol. Its IUPAC name is methyl 2-[[5-[[4-(benzenesulfonamido)-3-methylbenzoyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate.
| Compound Name | methyl 2-[[5-[[4-(benzenesulfonamido)-3-methylbenzoyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 100531277 |
| Molecular Formula | C19H18N4O5S3 |
| Molecular Weight | 478.58 g/mol |
| Exact Mass | 478.04 |
| IUPAC Name | methyl 2-[[5-[[4-(benzenesulfonamido)-3-methylbenzoyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
| SMILES | COC(=O)CSc1nnc(NC(=O)c2ccc(NS(=O)(=O)c3ccccc3)c(C)c2)s1 |
| InChI | InChI=1S/C19H18N4O5S3/c1-12-10-13(8-9-15(12)23-31(26,27)14-6-4-3-5-7-14)17(25)20-18-21-22-19(30-18)29-11-16(24)28-2/h3-10,23H,11H2,1-2H3,(H,20,21,25) |
| InChIKey | OOSHMNVYMBYDFU-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 127.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.58 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|