C19H16ClN3O4S2 — CID 100720072
methyl 2-[[5-[[3-[(2-chlorophenyl)methoxy]benzoyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate (PubChem CID 100720072) has the molecular formula C19H16ClN3O4S2 and a molecular weight of 449.94 g/mol. Its IUPAC name is methyl 2-[[5-[[3-[(2-chlorophenyl)methoxy]benzoyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate.
| Compound Name | methyl 2-[[5-[[3-[(2-chlorophenyl)methoxy]benzoyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 100720072 |
| Molecular Formula | C19H16ClN3O4S2 |
| Molecular Weight | 449.94 g/mol |
| Exact Mass | 449.03 |
| IUPAC Name | methyl 2-[[5-[[3-[(2-chlorophenyl)methoxy]benzoyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
| SMILES | COC(=O)CSc1nnc(NC(=O)c2cccc(OCc3ccccc3Cl)c2)s1 |
| InChI | InChI=1S/C19H16ClN3O4S2/c1-26-16(24)11-28-19-23-22-18(29-19)21-17(25)12-6-4-7-14(9-12)27-10-13-5-2-3-8-15(13)20/h2-9H,10-11H2,1H3,(H,21,22,25) |
| InChIKey | FEOYCDBIMFRUAQ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.94 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|