C20H20ClN3O2S2 — CID 2224724
3-butoxy-N-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 2224724) has the molecular formula C20H20ClN3O2S2 and a molecular weight of 433.99 g/mol. Its IUPAC name is 3-butoxy-N-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 3-butoxy-N-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 2224724 |
| Molecular Formula | C20H20ClN3O2S2 |
| Molecular Weight | 433.99 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | 3-butoxy-N-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | CCCCOc1cccc(C(=O)Nc2nnc(SCc3ccccc3Cl)s2)c1 |
| InChI | InChI=1S/C20H20ClN3O2S2/c1-2-3-11-26-16-9-6-8-14(12-16)18(25)22-19-23-24-20(28-19)27-13-15-7-4-5-10-17(15)21/h4-10,12H,2-3,11,13H2,1H3,(H,22,23,25) |
| InChIKey | MEAOSUAJSBXHQC-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.99 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|