C18H16ClN3O2S2 — CID 18864524
N-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-ethoxybenzamide (PubChem CID 18864524) has the molecular formula C18H16ClN3O2S2 and a molecular weight of 405.93 g/mol. Its IUPAC name is N-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-ethoxybenzamide.
| Compound Name | N-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-ethoxybenzamide |
|---|---|
| PubChem CID | 18864524 |
| Molecular Formula | C18H16ClN3O2S2 |
| Molecular Weight | 405.93 g/mol |
| Exact Mass | 405.04 |
| IUPAC Name | N-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-ethoxybenzamide |
| SMILES | CCOc1cccc(C(=O)Nc2nnc(SCc3ccc(Cl)cc3)s2)c1 |
| InChI | InChI=1S/C18H16ClN3O2S2/c1-2-24-15-5-3-4-13(10-15)16(23)20-17-21-22-18(26-17)25-11-12-6-8-14(19)9-7-12/h3-10H,2,11H2,1H3,(H,20,21,23) |
| InChIKey | GLEPQNFZHGAPOD-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.93 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|