C22H23ClN4O3S2 — CID 44956727
4-butoxy-N-[5-[2-[(2-chlorophenyl)methylamino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 44956727) has the molecular formula C22H23ClN4O3S2 and a molecular weight of 491.04 g/mol. Its IUPAC name is 4-butoxy-N-[5-[2-[(2-chlorophenyl)methylamino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 4-butoxy-N-[5-[2-[(2-chlorophenyl)methylamino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 44956727 |
| Molecular Formula | C22H23ClN4O3S2 |
| Molecular Weight | 491.04 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | 4-butoxy-N-[5-[2-[(2-chlorophenyl)methylamino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)Nc2nnc(SCC(=O)NCc3ccccc3Cl)s2)cc1 |
| InChI | InChI=1S/C22H23ClN4O3S2/c1-2-3-12-30-17-10-8-15(9-11-17)20(29)25-21-26-27-22(32-21)31-14-19(28)24-13-16-6-4-5-7-18(16)23/h4-11H,2-3,12-14H2,1H3,(H,24,28)(H,25,26,29) |
| InChIKey | CZWMXCUUNPVTFW-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.04 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|