C21H20Cl2N4O3S2 — CID 44956724
4-butoxy-N-[5-[2-(3,4-dichloroanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 44956724) has the molecular formula C21H20Cl2N4O3S2 and a molecular weight of 511.46 g/mol. Its IUPAC name is 4-butoxy-N-[5-[2-(3,4-dichloroanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 4-butoxy-N-[5-[2-(3,4-dichloroanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 44956724 |
| Molecular Formula | C21H20Cl2N4O3S2 |
| Molecular Weight | 511.46 g/mol |
| Exact Mass | 510.04 |
| IUPAC Name | 4-butoxy-N-[5-[2-(3,4-dichloroanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)Nc2nnc(SCC(=O)Nc3ccc(Cl)c(Cl)c3)s2)cc1 |
| InChI | InChI=1S/C21H20Cl2N4O3S2/c1-2-3-10-30-15-7-4-13(5-8-15)19(29)25-20-26-27-21(32-20)31-12-18(28)24-14-6-9-16(22)17(23)11-14/h4-9,11H,2-3,10,12H2,1H3,(H,24,28)(H,25,26,29) |
| InChIKey | ORNGMALCCPYUAX-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.46 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|